ChemNet > CAS > 6296-99-7 Diethyl aminomethylenemalonate
6296-99-7 Diethyl aminomethylenemalonate
| उत्पाद का नाम |
Diethyl aminomethylenemalonate |
| समानार्थी |
Aminomethylenemalonic acid diethyl ester; Diethyl(aminomethylene)malonate; diethyl (aminomethylidene)propanedioate; Diethyl 2-(aminomethylene)malonate |
| आणविक फार्मूला |
C8H13NO4 |
| आण्विक वजन |
187.1931 |
| InChI |
InChI=1/C8H13NO4/c1-3-12-7(10)6(5-9)8(11)13-4-2/h5H,3-4,9H2,1-2H3 |
| कैस रजिस्टी संख्या |
6296-99-7 |
| आणविक संरचना |
|
| घनत्व |
1.136g/cm3 |
| उबलने का समय |
263.4°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.471 |
| फ्लैश प्वाइंट |
105.3°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
R43:May cause sensitization by skin contact.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
