ChemNet > CAS > 6315-90-8 3,4-(Methylenedioxy)-6-nitrocinnamic acid
6315-90-8 3,4-(Methylenedioxy)-6-nitrocinnamic acid
उत्पाद का नाम |
3,4-(Methylenedioxy)-6-nitrocinnamic acid |
समानार्थी |
(2Z)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid; (2E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoic acid; (2E)-3-(6-nitro-1,3-benzodioxol-5-yl)prop-2-enoate |
आणविक फार्मूला |
C10H6NO6 |
आण्विक वजन |
236.1583 |
InChI |
InChI=1/C10H7NO6/c12-10(13)2-1-6-3-8-9(17-5-16-8)4-7(6)11(14)15/h1-4H,5H2,(H,12,13)/p-1/b2-1+ |
कैस रजिस्टी संख्या |
6315-90-8 |
आणविक संरचना |
|
उबलने का समय |
452.3°C at 760 mmHg |
फ्लैश प्वाइंट |
227.3°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S22:Do not inhale dust.;
S36:Wear suitable protective clothing.;
|
|