ChemNet > CAS > 6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
6324-10-3 4,5-Dibromothiophene-2-carboxylic acid
उत्पाद का नाम |
4,5-Dibromothiophene-2-carboxylic acid |
समानार्थी |
4,5-Dibromothenoic acid |
आणविक फार्मूला |
C5H2Br2O2S |
आण्विक वजन |
285.9412 |
InChI |
InChI=1/C5H2Br2O2S/c6-2-1-3(5(8)9)10-4(2)7/h1H,(H,8,9) |
कैस रजिस्टी संख्या |
6324-10-3 |
EINECS |
228-683-2 |
आणविक संरचना |
|
घनत्व |
2.309g/cm3 |
उबलने का समय |
367.1°C at 760 mmHg |
अपवर्तक सूचकांक |
1.682 |
फ्लैश प्वाइंट |
175.8°C |
खतरा प्रतीक |
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|