ChemNet > CAS > 6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
| उत्पाद का नाम |
5-nitro-1-benzothiophene-2-carboxylic acid |
| समानार्थी |
5-nitro-1-benzothiophene-2-carboxylate |
| आणविक फार्मूला |
C9H4NO4S |
| आण्विक वजन |
222.1979 |
| InChI |
InChI=1/C9H5NO4S/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1 |
| कैस रजिस्टी संख्या |
6345-55-7 |
| आणविक संरचना |
|
| गलनांक |
238℃ |
| उबलने का समय |
473.6°C at 760 mmHg |
| फ्लैश प्वाइंट |
240.2°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
