ChemNet > CAS > 6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
6345-55-7 5-nitro-1-benzothiophene-2-carboxylic acid
उत्पाद का नाम |
5-nitro-1-benzothiophene-2-carboxylic acid |
समानार्थी |
5-nitro-1-benzothiophene-2-carboxylate |
आणविक फार्मूला |
C9H4NO4S |
आण्विक वजन |
222.1979 |
InChI |
InChI=1/C9H5NO4S/c11-9(12)8-4-5-3-6(10(13)14)1-2-7(5)15-8/h1-4H,(H,11,12)/p-1 |
कैस रजिस्टी संख्या |
6345-55-7 |
आणविक संरचना |
|
गलनांक |
238℃ |
उबलने का समय |
473.6°C at 760 mmHg |
फ्लैश प्वाइंट |
240.2°C |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|