ChemNet > CAS > 6638-05-7 2,6-Dimethoxy-4-methylphenol
6638-05-7 2,6-Dimethoxy-4-methylphenol
| उत्पाद का नाम |
2,6-Dimethoxy-4-methylphenol |
| समानार्थी |
4-Methyl-2,6-dimethoxyphenol; 4-Hydroxy-3,5-dimethoxytoluene; 2,6-dimethoxy-4-methyl-phenol; 2,6-dimethoxy-p-cresol; 4-methylsyringol; 4-methylsyringol |
| आणविक फार्मूला |
C9H12O3 |
| आण्विक वजन |
168.1898 |
| InChI |
InChI=1/C9H12O3/c1-6-4-7(11-2)9(10)8(5-6)12-3/h4-5,10H,1-3H3 |
| कैस रजिस्टी संख्या |
6638-05-7 |
| EINECS |
229-641-6 |
| आणविक संरचना |
|
| घनत्व |
1.105g/cm3 |
| गलनांक |
35-146℃ |
| उबलने का समय |
268.3°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.52 |
| फ्लैश प्वाइंट |
116.1°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
