ChemNet > CAS > 700-35-6 2-chloro-4-fluoroacetophenone
700-35-6 2-chloro-4-fluoroacetophenone
उत्पाद का नाम |
2-chloro-4-fluoroacetophenone |
समानार्थी |
2'-chloro-4'-fluoroacetophenone; 1-(2-chloro-4-fluoro-phenyl)ethanone |
आणविक फार्मूला |
C8H6ClFO |
आण्विक वजन |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
कैस रजिस्टी संख्या |
700-35-6 |
आणविक संरचना |
|
घनत्व |
1.259g/cm3 |
उबलने का समय |
203.4°C at 760 mmHg |
अपवर्तक सूचकांक |
1.512 |
फ्लैश प्वाइंट |
76.814°C |
खतरा प्रतीक |
|
खतरे के कोड |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|