ChemNet > CAS > 700-96-9 3,4-Dimethoxythiophenol
700-96-9 3,4-Dimethoxythiophenol
| उत्पाद का नाम |
3,4-Dimethoxythiophenol |
| समानार्थी |
3,4-Dimethoxybenzenethiol |
| आणविक फार्मूला |
C8H10O2S |
| आण्विक वजन |
170.22 |
| InChI |
InChI=1/C8H10O2S/c1-9-7-4-3-6(11)5-8(7)10-2/h3-5,11H,1-2H3 |
| कैस रजिस्टी संख्या |
700-96-9 |
| आणविक संरचना |
|
| घनत्व |
1.19 |
| उबलने का समय |
110℃(1 torr) |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/38:Irritating to eyes and skin.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
