ChemNet > CAS > 7355-58-0 N-(2-Chloroethyl)acetamide
7355-58-0 N-(2-Chloroethyl)acetamide
उत्पाद का नाम |
N-(2-Chloroethyl)acetamide |
समानार्थी |
Acetamide, N-(2-chloroethyl)-; 4-04-00-00449 (Beilstein Handbook Reference); AI3-08685; BRN 1743108; NSC 30247 |
आणविक फार्मूला |
C4H8ClNO |
आण्विक वजन |
121.5654 |
InChI |
InChI=1/C4H8ClNO/c1-4(7)6-3-2-5/h2-3H2,1H3,(H,6,7) |
कैस रजिस्टी संख्या |
7355-58-0 |
EINECS |
230-884-5 |
आणविक संरचना |
|
घनत्व |
1.086g/cm3 |
उबलने का समय |
275.6°C at 760 mmHg |
अपवर्तक सूचकांक |
1.432 |
फ्लैश प्वाइंट |
120.4°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R33:Danger of cummulative effects.;
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|