ChemNet > CAS > 74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
74246-64-3 1,3-Thiazolin-4-one-2-acetonitrile
| उत्पाद का नाम |
1,3-Thiazolin-4-one-2-acetonitrile |
| समानार्थी |
2-(4-Oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile; (4-oxo-4,5-dihydro-1,3-thiazol-2-yl)acetonitrile |
| आणविक फार्मूला |
C5H4N2OS |
| आण्विक वजन |
140.1631 |
| InChI |
InChI=1/C5H4N2OS/c6-2-1-5-7-4(8)3-9-5/h1,3H2 |
| कैस रजिस्टी संख्या |
74246-64-3 |
| आणविक संरचना |
|
| घनत्व |
1.43g/cm3 |
| गलनांक |
185℃ |
| उबलने का समय |
300.6°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.675 |
| फ्लैश प्वाइंट |
135.6°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
|
|
