ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
उत्पाद का नाम |
Bromodichloromethane |
समानार्थी |
FC-20B1 |
आणविक फार्मूला |
CHBrCl2 |
आण्विक वजन |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
कैस रजिस्टी संख्या |
75-27-4 |
EINECS |
200-856-7 |
आणविक संरचना |
|
घनत्व |
2.013g/cm3 |
गलनांक |
-55℃ |
उबलने का समय |
89.7°C at 760 mmHg |
अपवर्तक सूचकांक |
1.503 |
फ्लैश प्वाइंट |
1.3°C |
खतरा प्रतीक |
Xn:Harmful;
|
खतरे के कोड |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|