ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
| उत्पाद का नाम |
Bromodichloromethane |
| समानार्थी |
FC-20B1 |
| आणविक फार्मूला |
CHBrCl2 |
| आण्विक वजन |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| कैस रजिस्टी संख्या |
75-27-4 |
| EINECS |
200-856-7 |
| आणविक संरचना |
|
| घनत्व |
2.013g/cm3 |
| गलनांक |
-55℃ |
| उबलने का समय |
89.7°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.503 |
| फ्लैश प्वाइंट |
1.3°C |
| खतरा प्रतीक |
 Xn:Harmful;
|
| खतरे के कोड |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| सुरक्षा विवरण |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
