ChemNet > CAS > 78881-21-7 4-Amino-3-methylbenzonitrile
78881-21-7 4-Amino-3-methylbenzonitrile
| उत्पाद का नाम |
4-Amino-3-methylbenzonitrile |
| समानार्थी |
4-Amino-m-tolunitrile; 4-Cyano-o-toluidine; 3-Methyl-4-aminobenzonitrile |
| आणविक फार्मूला |
C8H8N2 |
| आण्विक वजन |
132.1625 |
| InChI |
InChI=1/C8H8N2/c1-6-4-7(5-9)2-3-8(6)10/h2-4H,10H2,1H3 |
| कैस रजिस्टी संख्या |
78881-21-7 |
| आणविक संरचना |
|
| घनत्व |
1.1g/cm3 |
| उबलने का समय |
304.5°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.575 |
| फ्लैश प्वाइंट |
138°C |
| खतरा प्रतीक |
|
| खतरे के कोड |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| सुरक्षा विवरण |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
