ChemNet > CAS > 87-82-1 Hexabromobenzene
87-82-1 Hexabromobenzene
उत्पाद का नाम |
Hexabromobenzene |
समानार्थी |
AI3-60220; CCRIS 5917; HSDB 2912; NSC 113975; Benzene, 1,2,3,4,5,6-hexabromo-; Benzene, hexabromo- |
आणविक फार्मूला |
C6Br6 |
आण्विक वजन |
551.49
|
InChI |
InChI=1/C6Br6/c7-1-2(8)4(10)6(12)5(11)3(1)9 |
कैस रजिस्टी संख्या |
87-82-1 |
EINECS |
201-773-9 |
आणविक संरचना |
|
गलनांक |
326-327℃ |
खतरा प्रतीक |
Xi:Irritant;
|
खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|