ChemNet > CAS > 9003-53-6 Poly(styrene)
9003-53-6 Poly(styrene)
उत्पाद का नाम |
Poly(styrene) |
समानार्थी |
Polystyrene; polystyrene standard 4000000; polystyrene standard 2000000; polystyrene standard 300000; polystyrene standard 1000000; polystyrene standard 700000; polystyrene standard 650000; polystyrene standard 2200000 certi-fied acc. to din; polystyrene standard 500000; polystyrene standard 8000000; Polystyrene (General Purpose Grade); Polystyrene, dicarboxy terminated; Polystyrene, methacrylate terminated solution; Styrene Resin (High M.Wt.); Styrene Latex; Styrene Resin (Low M.Wt.); Styrene Resin (Med.M.Wt.); Styrene-divinylbenzene copolymer (20% cross-linked); Polystyrene2% crosslinked with vinylbenzene; EPS; Expandable Polystyrene |
आणविक फार्मूला |
C8H8 |
आण्विक वजन |
104.1491 |
InChI |
InChI=1/C9H8/c1-8(2)9-6-4-3-5-7-9/h1-8H |
कैस रजिस्टी संख्या |
9003-53-6 |
आणविक संरचना |
|
घनत्व |
1.047 |
उबलने का समय |
212℃ |
अपवर्तक सूचकांक |
1.5916 |
पानी की विलेयता |
insoluble |
खतरा प्रतीक |
Xi:;
|
खतरे के कोड |
41:;
|
सुरक्षा विवरण |
S24/25:;
|
|