ChemNet > CAS > 934-00-9 3-Methoxycatechol
934-00-9 3-Methoxycatechol
| उत्पाद का नाम |
3-Methoxycatechol |
| समानार्थी |
Pyrogallol monomethyl ether; pyrogallol-1-methyl ether; 2,3-Dihydroxyanisole~Pyrogallol 1-methyl ether; 3-methoxybenzene-1,2-diol |
| आणविक फार्मूला |
C7H8O3 |
| आण्विक वजन |
140.1366 |
| InChI |
InChI=1/C7H8O3/c1-10-6-4-2-3-5(8)7(6)9/h2-4,8-9H,1H3 |
| कैस रजिस्टी संख्या |
934-00-9 |
| EINECS |
213-276-4 |
| आणविक संरचना |
|
| घनत्व |
1.27g/cm3 |
| गलनांक |
39-43℃ |
| उबलने का समय |
268.1°C at 760 mmHg |
| अपवर्तक सूचकांक |
1.579 |
| फ्लैश प्वाइंट |
119.5°C |
| खतरा प्रतीक |
 Xi:Irritant;
|
| खतरे के कोड |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| सुरक्षा विवरण |
S24/25:Avoid contact with skin and eyes.;
|
|
