ChemNet > CAS > 96-20-8 (±)-2-Amino-1-butanol
96-20-8 (±)-2-Amino-1-butanol
| उत्पाद का नाम |
(±)-2-Amino-1-butanol |
| समानार्थी |
(-)-2-Aminobutanol; .+/-.-2-Amino-1-butanol; 1-butanol, 2-amino-; 2-Aminobutan-1-ol; 2-Amino-1-butanol; 2-aminobutan-2-ol; 2-Amino-1-butanol |
| आणविक फार्मूला |
C4H12NO |
| आण्विक वजन |
90.1436 |
| InChI |
InChI=1/C4H11NO/c1-2-4(5)3-6/h4,6H,2-3,5H2,1H3/p+1/t4-/m1/s1 |
| कैस रजिस्टी संख्या |
96-20-8 |
| EINECS |
202-488-2 |
| आणविक संरचना |
|
| गलनांक |
-2℃ |
| उबलने का समय |
177.2°C at 760 mmHg |
| फ्लैश प्वाइंट |
82.2°C |
| खतरा प्रतीक |
 C:Corrosive;
|
| खतरे के कोड |
R34:Causes burns.;
|
| सुरक्षा विवरण |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
