ChemNet > CAS > 101-17-7 3-Chlorodiphenylamine
101-17-7 3-Chlorodiphenylamine
| نام محصول |
3-Chlorodiphenylamine |
| مترادف |
Benzenamine, 3-chloro-N-phenyl-; 3-chloro-N-phenylaniline; 3-Chloro-N-phenyl-benzenamine; N-(3-chlorophenyl)aniline |
| میدان مغناطیسی |
C12H10ClN |
| وزن مولکولی |
203.6675 |
| InChI |
InChI=1/C12H10ClN/c13-10-5-4-8-12(9-10)14-11-6-2-1-3-7-11/h1-9,14H |
| شماره سیایاس |
101-17-7 |
| تعداد کمیسیون اروپایی |
202-922-0 |
| ساختار مولکولی |
|
| تراکم |
1.216g/cm3 |
| نقطه غلیان |
337.8°C at 760 mmHg |
| ضریب شکست |
1.642 |
| نقطه اشتعال |
147.4°C |
| خطر نمادها |
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
