ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
| نام محصول |
3-Hydroxyphenylacetylene |
| مترادف |
3-Ethynylphenol |
| میدان مغناطیسی |
C8H6O |
| وزن مولکولی |
118.1326 |
| InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
| شماره سیایاس |
10401-11-3 |
| ساختار مولکولی |
|
| تراکم |
1.12g/cm3 |
| نقطه غلیان |
230.9°C at 760 mmHg |
| ضریب شکست |
1.589 |
| نقطه اشتعال |
106.1°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
