ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
نام محصول |
3-Hydroxyphenylacetylene |
مترادف |
3-Ethynylphenol |
میدان مغناطیسی |
C8H6O |
وزن مولکولی |
118.1326 |
InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
شماره سیایاس |
10401-11-3 |
ساختار مولکولی |
|
تراکم |
1.12g/cm3 |
نقطه غلیان |
230.9°C at 760 mmHg |
ضریب شکست |
1.589 |
نقطه اشتعال |
106.1°C |
خطر نمادها |
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|