ChemNet > CAS > 105362-45-6 (5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methylamine
105362-45-6 (5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methylamine
نام محصول |
(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methylamine |
مترادف |
1-(5-methyl-2-phenyl-2H-1,2,3-triazol-4-yl)methanamine |
میدان مغناطیسی |
C10H12N4 |
وزن مولکولی |
188.2291 |
InChI |
InChI=1/C10H12N4/c1-8-10(7-11)13-14(12-8)9-5-3-2-4-6-9/h2-6H,7,11H2,1H3 |
شماره سیایاس |
105362-45-6 |
ساختار مولکولی |
|
تراکم |
1.23g/cm3 |
نقطه غلیان |
372.4°C at 760 mmHg |
ضریب شکست |
1.644 |
نقطه اشتعال |
179°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|