ChemNet > CAS > 110888-15-8 4-Chloro-3-fluorobenzonitrile
110888-15-8 4-Chloro-3-fluorobenzonitrile
| نام محصول |
4-Chloro-3-fluorobenzonitrile |
| مترادف |
BUTTPARK 45\01-08; 3-Fluoro-4-Chlorobenzonitrile; 4-chloro-3-fluorobenzontrile |
| میدان مغناطیسی |
C7H3ClFN |
| وزن مولکولی |
155.5568 |
| InChI |
InChI=1/C7H3ClFN/c8-6-2-1-5(4-10)3-7(6)9/h1-3H |
| شماره سیایاس |
110888-15-8 |
| ساختار مولکولی |
|
| تراکم |
1.33g/cm3 |
| نقطه ذوب |
79-81°C |
| نقطه غلیان |
214°C at 760 mmHg |
| ضریب شکست |
1.536 |
| نقطه اشتعال |
83.2°C |
| خطر نمادها |
 T,Xi:;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S36/37:Wear suitable protective clothing and gloves.;
|
|
