ChemNet > CAS > 111-21-7 Triethyleneglycoldiacetate
111-21-7 Triethyleneglycoldiacetate
| نام محصول |
Triethyleneglycoldiacetate |
| مترادف |
Triethylene glycol diacetate; ethane-1,2-diylbis(oxyethane-2,1-diyl) diacetate |
| میدان مغناطیسی |
C10H18O6 |
| وزن مولکولی |
234.2463 |
| InChI |
InChI=1/C10H18O6/c1-9(11)15-7-5-13-3-4-14-6-8-16-10(2)12/h3-8H2,1-2H3 |
| شماره سیایاس |
111-21-7 |
| تعداد کمیسیون اروپایی |
203-846-0 |
| ساختار مولکولی |
|
| تراکم |
1.098g/cm3 |
| نقطه غلیان |
286°C at 760 mmHg |
| ضریب شکست |
1.432 |
| نقطه اشتعال |
125.2°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
