ChemNet > CAS > 111-80-8 Methyl 2-nonynoate
111-80-8 Methyl 2-nonynoate
نام محصول |
Methyl 2-nonynoate |
مترادف |
2-Nonynoic acid methyl ester; 2-Nonynoic acid, methyl ester; Methyl octin carbonate; Methyl octine carbonate; Octynecarboxylic acid, methyl ester; methyl non-2-ynoate |
میدان مغناطیسی |
C10H16O2 |
وزن مولکولی |
168.2328 |
InChI |
InChI=1/C10H16O2/c1-3-4-5-6-7-8-9-10(11)12-2/h3-7H2,1-2H3 |
شماره سیایاس |
111-80-8 |
تعداد کمیسیون اروپایی |
203-909-2 |
ساختار مولکولی |
|
تراکم |
0.932g/cm3 |
نقطه غلیان |
233.1°C at 760 mmHg |
ضریب شکست |
1.446 |
نقطه اشتعال |
100.6°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|