ChemNet > CAS > 1117-31-3 1,3-butanediol diacetate
1117-31-3 1,3-butanediol diacetate
| نام محصول |
1,3-butanediol diacetate |
| مترادف |
1,3-butylene diacetate; 1,3-Butylene glycol diacetate; butane-1,3-diyl diacetate; 1,3-BGDA; 1,3-Diacetoxybutane |
| میدان مغناطیسی |
C8H14O4 |
| وزن مولکولی |
174.1944 |
| InChI |
InChI=1/C8H14O4/c1-6(12-8(3)10)4-5-11-7(2)9/h6H,4-5H2,1-3H3 |
| شماره سیایاس |
1117-31-3 |
| تعداد کمیسیون اروپایی |
214-244-2 |
| ساختار مولکولی |
|
| تراکم |
1.037g/cm3 |
| نقطه غلیان |
228.8°C at 760 mmHg |
| ضریب شکست |
1.421 |
| نقطه اشتعال |
102.6°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
