ChemNet > CAS > 111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol
111787-91-8 (2-methyl-5-phenyl-3-furyl)methanol
| نام محصول |
(2-methyl-5-phenyl-3-furyl)methanol |
| مترادف |
(2-methyl-5-phenylfuran-3-yl)methanol |
| میدان مغناطیسی |
C12H12O2 |
| وزن مولکولی |
188.2225 |
| InChI |
InChI=1/C12H12O2/c1-9-11(8-13)7-12(14-9)10-5-3-2-4-6-10/h2-7,13H,8H2,1H3 |
| شماره سیایاس |
111787-91-8 |
| ساختار مولکولی |
|
| تراکم |
1.123g/cm3 |
| نقطه ذوب |
22℃ |
| نقطه غلیان |
233.9°C at 760 mmHg |
| ضریب شکست |
1.562 |
| نقطه اشتعال |
95.2°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
