ChemNet > CAS > 1119-46-6 5-Chlorovaleric acid
1119-46-6 5-Chlorovaleric acid
نام محصول |
5-Chlorovaleric acid |
مترادف |
214-279-3; pentanoic acid, 5-chloro-; 5-chloropentanoic acid |
میدان مغناطیسی |
C5H9ClO2 |
وزن مولکولی |
136.5768 |
InChI |
InChI=1/C5H9ClO2/c6-4-2-1-3-5(7)8/h1-4H2,(H,7,8) |
شماره سیایاس |
1119-46-6 |
تعداد کمیسیون اروپایی |
214-279-3 |
ساختار مولکولی |
|
تراکم |
1.166g/cm3 |
نقطه ذوب |
18-20℃ |
نقطه غلیان |
230.9°C at 760 mmHg |
ضریب شکست |
1.452 |
نقطه اشتعال |
93.4°C |
خطر نمادها |
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|