ChemNet > CAS > 1122-60-7 nitrocyclohexane
1122-60-7 nitrocyclohexane
| نام محصول |
nitrocyclohexane |
| مترادف |
Hexahydronitrobenzene |
| میدان مغناطیسی |
C6H11NO2 |
| وزن مولکولی |
129.157 |
| InChI |
InChI=1/C6H11NO2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2 |
| شماره سیایاس |
1122-60-7 |
| تعداد کمیسیون اروپایی |
214-354-0 |
| ساختار مولکولی |
|
| تراکم |
1.05g/cm3 |
| نقطه غلیان |
202.8°C at 760 mmHg |
| ضریب شکست |
1.465 |
| نقطه اشتعال |
81.2°C |
| خطر نمادها |
|
| کدهای خطر |
R23/24/25:Toxic by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
