ChemNet > CAS > 116632-39-4 Bromoiodotoluene
116632-39-4 Bromoiodotoluene
| نام محصول |
Bromoiodotoluene |
| مترادف |
5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
| میدان مغناطیسی |
C7H6BrI |
| وزن مولکولی |
296.931 |
| InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
| شماره سیایاس |
116632-39-4 |
| ساختار مولکولی |
|
| تراکم |
2.062g/cm3 |
| نقطه غلیان |
264.2°C at 760 mmHg |
| ضریب شکست |
1.636 |
| نقطه اشتعال |
113.6°C |
| خطر نمادها |
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
