ChemNet > CAS > 1195-09-1 3-Hydroxy-4-methoxytoluene
1195-09-1 3-Hydroxy-4-methoxytoluene
| نام محصول |
3-Hydroxy-4-methoxytoluene |
| مترادف |
2-Methoxy-5-methylphenol; Isocreosol~5-Methylguaiacol |
| میدان مغناطیسی |
C8H10O2 |
| وزن مولکولی |
138.1638 |
| InChI |
InChI=1/C8H10O2/c1-6-3-4-8(10-2)7(9)5-6/h3-5,9H,1-2H3 |
| شماره سیایاس |
1195-09-1 |
| تعداد کمیسیون اروپایی |
214-791-7 |
| ساختار مولکولی |
|
| تراکم |
1.078g/cm3 |
| نقطه غلیان |
226.4°C at 760 mmHg |
| ضریب شکست |
1.53 |
| نقطه اشتعال |
99°C |
| خطر نمادها |
|
| کدهای خطر |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
