ChemNet > CAS > 1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile
1206-15-1 1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile
| نام محصول |
1-(4-Methoxyphenyl)-1-cyclopentanecarbonitrile |
| مترادف |
1-(4-Methoxyphenyl)cyclopentanecarbonitrile |
| میدان مغناطیسی |
C13H15NO |
| وزن مولکولی |
201.2643 |
| InChI |
InChI=1/C13H15NO/c1-15-12-6-4-11(5-7-12)13(10-14)8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
| شماره سیایاس |
1206-15-1 |
| تعداد کمیسیون اروپایی |
214-890-5 |
| ساختار مولکولی |
|
| تراکم |
1.07g/cm3 |
| نقطه غلیان |
346.4°C at 760 mmHg |
| ضریب شکست |
1.543 |
| نقطه اشتعال |
146.2°C |
| خطر نمادها |
 Xn:Harmful;
|
| کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
