ChemNet > CAS > 1214-47-7 1-(2-hydroxyphenyl)-3-phenyl-2-propenone
1214-47-7 1-(2-hydroxyphenyl)-3-phenyl-2-propenone
نام محصول |
1-(2-hydroxyphenyl)-3-phenyl-2-propenone |
مترادف |
2-Hydroxychalcone; Benzylidene(2-hydroxyacetophenone); 1-(2-Hydroxyphenyl)-3-phenyl-2-propen-1-one; (2E)-1-(2-hydroxyphenyl)-3-phenylprop-2-en-1-one; 2'-Hydroxychalcone; 2'-HYDROXY BENZALACETOPHENONE; 2-Hydroxybenzalacetophenone |
میدان مغناطیسی |
C15H12O2 |
وزن مولکولی |
224.2546 |
InChI |
InChI=1/C15H12O2/c16-14-9-5-4-8-13(14)15(17)11-10-12-6-2-1-3-7-12/h1-11,16H/b11-10+ |
شماره سیایاس |
1214-47-7 |
تعداد کمیسیون اروپایی |
214-928-0 |
ساختار مولکولی |
|
تراکم |
1.191g/cm3 |
نقطه ذوب |
88-92℃ |
نقطه غلیان |
396.6°C at 760 mmHg |
ضریب شکست |
1.653 |
نقطه اشتعال |
169.4°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|