ChemNet > CAS > 127957-83-9 ethyl 2-amino-4-propylpyrimidine-5-carboxylate
127957-83-9 ethyl 2-amino-4-propylpyrimidine-5-carboxylate
نام محصول |
ethyl 2-amino-4-propylpyrimidine-5-carboxylate |
میدان مغناطیسی |
C10H15N3O2 |
وزن مولکولی |
209.245 |
InChI |
InChI=1/C10H15N3O2/c1-3-5-8-7(9(14)15-4-2)6-12-10(11)13-8/h6H,3-5H2,1-2H3,(H2,11,12,13) |
شماره سیایاس |
127957-83-9 |
ساختار مولکولی |
|
تراکم |
1.15g/cm3 |
نقطه ذوب |
127℃ |
نقطه غلیان |
396.9°C at 760 mmHg |
ضریب شکست |
1.542 |
نقطه اشتعال |
193.8°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|