ChemNet > CAS > 131738-73-3 1-Bromo-3-isopropoxybenzene
131738-73-3 1-Bromo-3-isopropoxybenzene
| نام محصول |
1-Bromo-3-isopropoxybenzene |
| مترادف |
2-(3-Bromophenoxy)propane~3-Bromophenyl isopropyl ether; 3-Bromophenyl isopropyl ether; 1-bromo-3-(1-methylethoxy)benzene |
| میدان مغناطیسی |
C9H11BrO |
| وزن مولکولی |
215.087 |
| InChI |
InChI=1/C9H11BrO/c1-7(2)11-9-5-3-4-8(10)6-9/h3-7H,1-2H3 |
| شماره سیایاس |
131738-73-3 |
| ساختار مولکولی |
|
| تراکم |
1.319g/cm3 |
| نقطه غلیان |
232°C at 760 mmHg |
| ضریب شکست |
1.523 |
| نقطه اشتعال |
104.2°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
