ChemNet > CAS > 13194-67-7 4-fluoro-2-iodotoluene
13194-67-7 4-fluoro-2-iodotoluene
| نام محصول |
4-fluoro-2-iodotoluene |
| مترادف |
4-Fluoro-2-iodo-1-methylbenzene |
| میدان مغناطیسی |
C7H6FI |
| وزن مولکولی |
236.0254 |
| InChI |
InChI=1/C7H6FI/c1-5-2-3-6(8)4-7(5)9/h2-4H,1H3 |
| شماره سیایاس |
13194-67-7 |
| تعداد کمیسیون اروپایی |
236-153-7 |
| ساختار مولکولی |
|
| تراکم |
1.788g/cm3 |
| نقطه غلیان |
205.1°C at 760 mmHg |
| ضریب شکست |
1.58 |
| نقطه اشتعال |
81°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/38:Irritating to eyes and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
