ChemNet > CAS > 135-00-2 2-Benzoylthiophene
135-00-2 2-Benzoylthiophene
| نام محصول |
2-Benzoylthiophene |
| مترادف |
2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
| میدان مغناطیسی |
C11H8OS |
| وزن مولکولی |
188.2456 |
| InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
| شماره سیایاس |
135-00-2 |
| تعداد کمیسیون اروپایی |
205-169-6 |
| ساختار مولکولی |
|
| تراکم |
1.198g/cm3 |
| نقطه غلیان |
300°C at 760 mmHg |
| ضریب شکست |
1.609 |
| نقطه اشتعال |
139.7°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
