ChemNet > CAS > 13524-04-4 1-(2-Chlorophenyl)ethanol
13524-04-4 1-(2-Chlorophenyl)ethanol
| نام محصول |
1-(2-Chlorophenyl)ethanol |
| مترادف |
2-Chloro-alpha-methylbenzyl alcohol; (1S)-1-(2-chlorophenyl)ethanol; (1R)-1-(2-chlorophenyl)ethanol |
| میدان مغناطیسی |
C8H9ClO |
| وزن مولکولی |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m1/s1 |
| شماره سیایاس |
13524-04-4 |
| تعداد کمیسیون اروپایی |
236-868-4 |
| ساختار مولکولی |
|
| تراکم |
1.182g/cm3 |
| نقطه غلیان |
231.4°C at 760 mmHg |
| ضریب شکست |
1.55 |
| نقطه اشتعال |
93.8°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|
