ChemNet > CAS > 137-97-3 1,3-di-O-tolyl-2-thiourea
137-97-3 1,3-di-O-tolyl-2-thiourea
نام محصول |
1,3-di-O-tolyl-2-thiourea |
مترادف |
Ditolylthiourea; N,N-Di-o-tolylthiourea; N,N-Bis(2-Methylphenyl)thiourea; N,N,N-trimethyl(phenyl)methanaminium bromide; 1,3-bis(2-methylphenyl)thiourea |
میدان مغناطیسی |
C15H16N2S |
وزن مولکولی |
256.3659 |
InChI |
InChI=1/C15H16N2S/c1-11-7-3-5-9-13(11)16-15(18)17-14-10-6-4-8-12(14)2/h3-10H,1-2H3,(H2,16,17,18) |
شماره سیایاس |
137-97-3 |
تعداد کمیسیون اروپایی |
205-309-6 |
ساختار مولکولی |
|
تراکم |
1.219g/cm3 |
نقطه ذوب |
157-159℃ |
نقطه غلیان |
367.5°C at 760 mmHg |
ضریب شکست |
1.707 |
نقطه اشتعال |
176°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|