ChemNet > CAS > 139-87-7 N-Ethyldiethanolamine
139-87-7 N-Ethyldiethanolamine
نام محصول |
N-Ethyldiethanolamine |
مترادف |
2,2-(Ethylimino)diethanol; Ethyldiethanolamine; N-ethyl-2-hydroxy-N-(2-hydroxyethyl)ethanaminium |
میدان مغناطیسی |
C6H16NO2 |
وزن مولکولی |
134.1962 |
InChI |
InChI=1/C6H15NO2/c1-2-7(3-5-8)4-6-9/h8-9H,2-6H2,1H3/p+1 |
شماره سیایاس |
139-87-7 |
تعداد کمیسیون اروپایی |
205-379-8 |
ساختار مولکولی |
|
نقطه ذوب |
-50℃ |
نقطه غلیان |
246.4°C at 760 mmHg |
نقطه اشتعال |
123.9°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|