ChemNet > CAS > 13979-81-2 3,5-Dibromo-4-methylphenol
13979-81-2 3,5-Dibromo-4-methylphenol
نام محصول |
3,5-Dibromo-4-methylphenol |
مترادف |
3,5-Dibromo-p-cresol (OH=1); 3,5-Dibromo-p-cresol |
میدان مغناطیسی |
C7H6Br2O |
وزن مولکولی |
265.9299 |
InChI |
InChI=1/C7H6Br2O/c1-4-6(8)2-5(10)3-7(4)9/h2-3,10H,1H3 |
شماره سیایاس |
13979-81-2 |
تعداد کمیسیون اروپایی |
237-763-6 |
ساختار مولکولی |
|
تراکم |
1.948g/cm3 |
نقطه غلیان |
293.1°C at 760 mmHg |
ضریب شکست |
1.626 |
نقطه اشتعال |
131.1°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|