ChemNet > CAS > 1422-54-4 2-Bromo-6-fluorotoluene
1422-54-4 2-Bromo-6-fluorotoluene
| نام محصول |
2-Bromo-6-fluorotoluene |
| مترادف |
Bromofluorotoluene3; 5-chloro-6-fluoro-1,3-dihydro-2H-benzimidazole-2-thione |
| میدان مغناطیسی |
C7H4ClFN2S |
| وزن مولکولی |
202.6365 |
| InChI |
InChI=1/C7H4ClFN2S/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,(H2,10,11,12) |
| شماره سیایاس |
1422-54-4 |
| ساختار مولکولی |
|
| تراکم |
1.63g/cm3 |
| نقطه غلیان |
294°C at 760 mmHg |
| ضریب شکست |
1.714 |
| نقطه اشتعال |
131.6°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
