ChemNet > CAS > 1440-61-5 4-(2-Chloroacetyl)morpholine
1440-61-5 4-(2-Chloroacetyl)morpholine
| نام محصول |
4-(2-Chloroacetyl)morpholine |
| مترادف |
2-Chloro-1-morpholinoethan-1-one; 2-chloro-1-(morpholin-4-yl)ethanone |
| میدان مغناطیسی |
C6H10ClNO2 |
| وزن مولکولی |
163.6021 |
| InChI |
InChI=1/C6H10ClNO2/c7-5-6(9)8-1-3-10-4-2-8/h1-5H2 |
| شماره سیایاس |
1440-61-5 |
| تعداد کمیسیون اروپایی |
215-880-3 |
| ساختار مولکولی |
|
| تراکم |
1.246g/cm3 |
| نقطه ذوب |
27-30 °C |
| نقطه غلیان |
294.2°C at 760 mmHg |
| ضریب شکست |
1.486 |
| نقطه اشتعال |
131.8°C |
| خطر نمادها |
 C:Corrosive;
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
