ChemNet > CAS > 148583-59-9 1-(2,6-Dimethoxyphenyl)piperazine
148583-59-9 1-(2,6-Dimethoxyphenyl)piperazine
| نام محصول |
1-(2,6-Dimethoxyphenyl)piperazine |
| میدان مغناطیسی |
C12H18N2O2 |
| وزن مولکولی |
222.2835 |
| InChI |
InChI=1/C12H18N2O2/c1-15-10-4-3-5-11(16-2)12(10)14-8-6-13-7-9-14/h3-5,13H,6-9H2,1-2H3 |
| شماره سیایاس |
148583-59-9 |
| ساختار مولکولی |
|
| تراکم |
1.08g/cm3 |
| نقطه غلیان |
375.4°C at 760 mmHg |
| ضریب شکست |
1.526 |
| نقطه اشتعال |
180.8°C |
| خطر نمادها |
|
| کدهای خطر |
R34:Causes burns.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
