ChemNet > CAS > 154264-95-6 7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine
154264-95-6 7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine
نام محصول |
7-bromo-4-methyl-3,4-dihydro-2H-1,4-benzoxazine |
مترادف |
7-bromo-4-methyl-2,3-dihydro-1,4-benzoxazine |
میدان مغناطیسی |
C9H10BrNO |
وزن مولکولی |
228.0858 |
InChI |
InChI=1/C9H10BrNO/c1-11-4-5-12-9-6-7(10)2-3-8(9)11/h2-3,6H,4-5H2,1H3 |
شماره سیایاس |
154264-95-6 |
ساختار مولکولی |
|
تراکم |
1.476g/cm3 |
نقطه غلیان |
309.187°C at 760 mmHg |
ضریب شکست |
1.579 |
نقطه اشتعال |
140.792°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|