ChemNet > CAS > 1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
1548-74-9 4-amino-2,3,5,6-tetrafluorobenzamide
| نام محصول |
4-amino-2,3,5,6-tetrafluorobenzamide |
| میدان مغناطیسی |
C7H4F4N2O |
| وزن مولکولی |
208.1131 |
| InChI |
InChI=1/C7H4F4N2O/c8-2-1(7(13)14)3(9)5(11)6(12)4(2)10/h12H2,(H2,13,14) |
| شماره سیایاس |
1548-74-9 |
| تعداد کمیسیون اروپایی |
216-285-1 |
| ساختار مولکولی |
|
| تراکم |
1.635g/cm3 |
| نقطه ذوب |
185-186℃ |
| نقطه غلیان |
148.4°C at 760 mmHg |
| ضریب شکست |
1.531 |
| نقطه اشتعال |
43.5°C |
| خطر نمادها |
 Xi:Irritant;
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
