| نام محصول |
Melamine Pyrophosphate |
| مترادف |
Diphosphoric acid, compd. with 1,3,5-triazine-2,4,6-triamine (1:?); Diphosphoric acid, compd. with 1,3,5-triazine-2,4,6-triamine; Melamine, compd. with diphosphoric acid; Diphosphoric acid, compound with 1,3,5-triazine-2,4,6-triamine; diphosphoric acid - 1,3,5-triazine-2,4,6-triamine (1:1) |
| میدان مغناطیسی |
C3H10N6O7P2 |
| وزن مولکولی |
304.095 |
| InChI |
InChI=1/C3H6N6.H4O7P2/c4-1-7-2(5)9-3(6)8-1;1-8(2,3)7-9(4,5)6/h(H6,4,5,6,7,8,9);(H2,1,2,3)(H2,4,5,6) |
| شماره سیایاس |
15541-60-3 |
| تعداد کمیسیون اروپایی |
239-590-1 |
| ساختار مولکولی |
|
| نقطه غلیان |
557.5°C at 760 mmHg |
| نقطه اشتعال |
325.3°C |
| خطر نمادها |
|
| کدهای خطر |
|
| توضیحات ایمنی |
|
|
