ChemNet > CAS > 15822-77-2 1-(2-nitrophenyl)piperidine
15822-77-2 1-(2-nitrophenyl)piperidine
نام محصول |
1-(2-nitrophenyl)piperidine |
مترادف |
1-(2-Nitrophenyl)piperidine; 1-(O-Nitrophenyl)piperidine; Piperidine, 1-(2-nitrophenyl)- |
میدان مغناطیسی |
C11H14N2O2 |
وزن مولکولی |
206.2411 |
InChI |
InChI=1/C11H14N2O2/c14-13(15)11-7-3-2-6-10(11)12-8-4-1-5-9-12/h2-3,6-7H,1,4-5,8-9H2 |
شماره سیایاس |
15822-77-2 |
ساختار مولکولی |
|
تراکم |
1.188g/cm3 |
نقطه ذوب |
77℃ |
نقطه غلیان |
337.7°C at 760 mmHg |
ضریب شکست |
1.578 |
نقطه اشتعال |
158°C |
خطر نمادها |
Xi:Irritant;
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|