ChemNet > CAS > 16152-51-5 4-Isopropylbenzeneboronic acid
16152-51-5 4-Isopropylbenzeneboronic acid
نام محصول |
4-Isopropylbenzeneboronic acid |
مترادف |
4-Cumylboronic acid; [4-(1-methylethyl)phenyl]boronic acid; 4-Isopropylphenylboronic acid; 4-Isoprophenylboronic Acid |
میدان مغناطیسی |
C9H13BO2 |
وزن مولکولی |
164.0093 |
InChI |
InChI=1/C9H13BO2/c1-7(2)8-3-5-9(6-4-8)10(11)12/h3-7,11-12H,1-2H3 |
شماره سیایاس |
16152-51-5 |
ساختار مولکولی |
|
تراکم |
1.04g/cm3 |
نقطه غلیان |
285.9°C at 760 mmHg |
ضریب شکست |
1.513 |
نقطه اشتعال |
126.7°C |
خطر نمادها |
|
کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|