ChemNet > CAS > 1635-31-0 3-Aminocoumarin
1635-31-0 3-Aminocoumarin
| نام محصول |
3-Aminocoumarin |
| مترادف |
3-Coumarinamine; 3-amino-2H-chromen-2-one |
| میدان مغناطیسی |
C9H7NO2 |
| وزن مولکولی |
161.1574 |
| InChI |
InChI=1/C9H7NO2/c10-7-5-6-3-1-2-4-8(6)12-9(7)11/h1-5H,10H2 |
| شماره سیایاس |
1635-31-0 |
| تعداد کمیسیون اروپایی |
216-659-4 |
| ساختار مولکولی |
|
| تراکم |
1.313g/cm3 |
| نقطه غلیان |
355.2°C at 760 mmHg |
| ضریب شکست |
1.624 |
| نقطه اشتعال |
199.3°C |
| خطر نمادها |
|
| کدهای خطر |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
