ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
نام محصول |
5-Nitrothiophene-2-carbonitrile |
مترادف |
2-Cyano-5-nitrothiophene |
میدان مغناطیسی |
C5H2N2O2S |
وزن مولکولی |
154.1466 |
InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
شماره سیایاس |
16689-02-4 |
ساختار مولکولی |
|
تراکم |
1.5g/cm3 |
نقطه غلیان |
273.9°C at 760 mmHg |
ضریب شکست |
1.611 |
نقطه اشتعال |
119.4°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|