ChemNet > CAS > 16718-12-0 2-(Phenylthio)thiophene
16718-12-0 2-(Phenylthio)thiophene
نام محصول |
2-(Phenylthio)thiophene |
مترادف |
Phenyl 2-thienyl sulphide; 2-(phenylsulfanyl)thiophene; 2-(phenylthio)-thiophene |
میدان مغناطیسی |
C10H8S2 |
وزن مولکولی |
192.3005 |
InChI |
InChI=1/C10H8S2/c1-2-5-9(6-3-1)12-10-7-4-8-11-10/h1-8H |
شماره سیایاس |
16718-12-0 |
ساختار مولکولی |
|
تراکم |
1.24g/cm3 |
نقطه غلیان |
304.7°C at 760 mmHg |
ضریب شکست |
1.667 |
نقطه اشتعال |
138.1°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|