ChemNet > CAS > 170230-87-2 4-Amino-3-ethylbenzonitrile
170230-87-2 4-Amino-3-ethylbenzonitrile
نام محصول |
4-Amino-3-ethylbenzonitrile |
مترادف |
4-Cyano-2-ethylaniline |
میدان مغناطیسی |
C9H10N2 |
وزن مولکولی |
146.1891 |
InChI |
InChI=1/C9H10N2/c1-2-8-5-7(6-10)3-4-9(8)11/h3-5H,2,11H2,1H3 |
شماره سیایاس |
170230-87-2 |
ساختار مولکولی |
|
تراکم |
1.07g/cm3 |
نقطه غلیان |
297.1°C at 760 mmHg |
ضریب شکست |
1.562 |
نقطه اشتعال |
133.5°C |
خطر نمادها |
|
کدهای خطر |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
توضیحات ایمنی |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|