ChemNet > CAS > 1706-11-2 2,5-Dimethylanisole
1706-11-2 2,5-Dimethylanisole
نام محصول |
2,5-Dimethylanisole |
مترادف |
1,4-Dimethyl-2-methoxybenzene; 2-Methoxy-p-xylene; 2,5-dimethylphenyl methyl ether |
میدان مغناطیسی |
C9H12O |
وزن مولکولی |
136.191 |
InChI |
InChI=1/C9H12O/c1-7-4-5-8(2)9(6-7)10-3/h4-6H,1-3H3 |
شماره سیایاس |
1706-11-2 |
تعداد کمیسیون اروپایی |
216-943-8 |
ساختار مولکولی |
|
تراکم |
0.932g/cm3 |
نقطه غلیان |
189.7°C at 760 mmHg |
ضریب شکست |
1.495 |
نقطه اشتعال |
66.1°C |
خطر نمادها |
|
کدهای خطر |
|
توضیحات ایمنی |
S24/25:Avoid contact with skin and eyes.;
|
|